Other Solvents
Filtered Search Results
p-Dioxane, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 123-91-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 InChI Key: RYHBNJHYFVUHQT-UHFFFAOYSA-N Synonym: dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin PubChem CID: 31275 ChEBI: CHEBI:47032 IUPAC Name: 1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 31275 |
|---|---|
| CAS | 123-91-1 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:47032 |
| SMILES | C1COCCO1 |
| Synonym | dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin |
| IUPAC Name | 1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
2-Chloro-6-methylphenyl isocyanate, 97%
CAS: 40398-01-4 Molecular Formula: C8H6ClNO Molecular Weight (g/mol): 167.592 MDL Number: MFCD00037030 InChI Key: FBTQQNYGMICJQZ-UHFFFAOYSA-N Synonym: 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate PubChem CID: 268123 IUPAC Name: 1-chloro-2-isocyanato-3-methylbenzene SMILES: CC1=C(C(=CC=C1)Cl)N=C=O
| PubChem CID | 268123 |
|---|---|
| CAS | 40398-01-4 |
| Molecular Weight (g/mol) | 167.592 |
| MDL Number | MFCD00037030 |
| SMILES | CC1=C(C(=CC=C1)Cl)N=C=O |
| Synonym | 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate |
| IUPAC Name | 1-chloro-2-isocyanato-3-methylbenzene |
| InChI Key | FBTQQNYGMICJQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNO |
1-Butanol, PHOTREX™ Reagent, J.T. Baker™
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
5-Bromo-m-xylene, 98%
CAS: 556-96-7 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.06 InChI Key: LMFRTSBQRLSJHC-UHFFFAOYSA-N Synonym: 5-bromo-m-xylene,3,5-dimethylbromobenzene,benzene, 1-bromo-3,5-dimethyl,m-xylene, 5-bromo,5-bromo-1,3-xylene,5-bromo-1,3-dimethylbenzene,1-bromo-3,5-dimethyl-benzene,5-bromo-meta-xylene,5-bromo-3,5-dimethylbenzene,1-bromo-3,5-dimethyl benzene PubChem CID: 136357 IUPAC Name: 1-bromo-3,5-dimethylbenzene SMILES: CC1=CC(=CC(=C1)Br)C
| PubChem CID | 136357 |
|---|---|
| CAS | 556-96-7 |
| Molecular Weight (g/mol) | 185.06 |
| SMILES | CC1=CC(=CC(=C1)Br)C |
| Synonym | 5-bromo-m-xylene,3,5-dimethylbromobenzene,benzene, 1-bromo-3,5-dimethyl,m-xylene, 5-bromo,5-bromo-1,3-xylene,5-bromo-1,3-dimethylbenzene,1-bromo-3,5-dimethyl-benzene,5-bromo-meta-xylene,5-bromo-3,5-dimethylbenzene,1-bromo-3,5-dimethyl benzene |
| IUPAC Name | 1-bromo-3,5-dimethylbenzene |
| InChI Key | LMFRTSBQRLSJHC-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
Methanol-d4, for NMR, contains 0.03 v/v% TMS, 99.8 atom % D
CAS: 811-98-3 Molecular Formula: CH4O MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: trideuterio deuteriooxy methane,perdeuteromethanol,methyl-d3 alcohol-d,methan-d3-ol-d,methyl alcohol-d4,tetradeuteromethanol,2h4 methanol,cd3od,methanol-d4,methanol-d4, 99.8 atom % d PubChem CID: 71568
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| MDL Number | MFCD00044637 |
| Synonym | trideuterio deuteriooxy methane,perdeuteromethanol,methyl-d3 alcohol-d,methan-d3-ol-d,methyl alcohol-d4,tetradeuteromethanol,2h4 methanol,cd3od,methanol-d4,methanol-d4, 99.8 atom % d |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
4-Chlorobenzyl isothiocyanate, 97%
CAS: 3694-45-9 Molecular Formula: C8H6ClNS Molecular Weight (g/mol): 183.653 MDL Number: MFCD00041116 InChI Key: DEHXIHUIYSXZNH-UHFFFAOYSA-N Synonym: 4-chlorobenzyl isothiocyanate,1-chloro-4-isothiocyanatomethyl benzene,p-chlorobenzyl isothiocyanate,benzene, 1-chloro-4-isothiocyanatomethyl,isothiocyanic acid, p-chlorobenzyl ester,4-chlorobenzylisothiocyanate,benzene, 1-chloro-4-isothiocyanatomethyl-9ci,acmc-1cng5,wln: scn1r dg,p-chlorobenzylisothiocyanate PubChem CID: 19408 IUPAC Name: 1-chloro-4-(isothiocyanatomethyl)benzene SMILES: C1=CC(=CC=C1CN=C=S)Cl
| PubChem CID | 19408 |
|---|---|
| CAS | 3694-45-9 |
| Molecular Weight (g/mol) | 183.653 |
| MDL Number | MFCD00041116 |
| SMILES | C1=CC(=CC=C1CN=C=S)Cl |
| Synonym | 4-chlorobenzyl isothiocyanate,1-chloro-4-isothiocyanatomethyl benzene,p-chlorobenzyl isothiocyanate,benzene, 1-chloro-4-isothiocyanatomethyl,isothiocyanic acid, p-chlorobenzyl ester,4-chlorobenzylisothiocyanate,benzene, 1-chloro-4-isothiocyanatomethyl-9ci,acmc-1cng5,wln: scn1r dg,p-chlorobenzylisothiocyanate |
| IUPAC Name | 1-chloro-4-(isothiocyanatomethyl)benzene |
| InChI Key | DEHXIHUIYSXZNH-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNS |
| Chemical Name or Material | Beta Max-ES liquid scintillation cocktail |
|---|
Xylenes, 99+%, for residue analysis, mixed, electronic use grade
CAS: 1330-20-7 Molecular Formula: C8H10 MDL Number: MFCD00077264 Synonym: Dimethylbenzene
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| Synonym | Dimethylbenzene |
| Molecular Formula | C8H10 |
Nitrobenzene-d5, for NMR, 99 atom % D
CAS: 4165-60-0 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 128.14 MDL Number: MFCD00044415 InChI Key: LQNUZADURLCDLV-RALIUCGRSA-N Synonym: nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard PubChem CID: 123210 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-nitrobenzene SMILES: [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O
| PubChem CID | 123210 |
|---|---|
| CAS | 4165-60-0 |
| Molecular Weight (g/mol) | 128.14 |
| MDL Number | MFCD00044415 |
| SMILES | [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O |
| Synonym | nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-nitrobenzene |
| InChI Key | LQNUZADURLCDLV-RALIUCGRSA-N |
| Molecular Formula | C6H5NO2 |
Acetic anhydride-d6, for NMR, 98.5 atom % D
CAS: 16649-49-3 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 108.13 MDL Number: MFCD00044225 InChI Key: WFDIJRYMOXRFFG-WFGJKAKNSA-N Synonym: acetic anhydride-d6,2h3 acetic anhydride,acetic anhydride d6,2h3 acetyl 2h3 acetate,acetic anhydride-d6, 99 atom % d,2 h? acetyl 2 h? acetate,2,2,2-trideuterioacetyl 2,2,2-trideuterioacetate PubChem CID: 2723966 IUPAC Name: (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate SMILES: [2H]C([2H])([2H])C(=O)OC(=O)C([2H])([2H])[2H]
| PubChem CID | 2723966 |
|---|---|
| CAS | 16649-49-3 |
| Molecular Weight (g/mol) | 108.13 |
| MDL Number | MFCD00044225 |
| SMILES | [2H]C([2H])([2H])C(=O)OC(=O)C([2H])([2H])[2H] |
| Synonym | acetic anhydride-d6,2h3 acetic anhydride,acetic anhydride d6,2h3 acetyl 2h3 acetate,acetic anhydride-d6, 99 atom % d,2 h? acetyl 2 h? acetate,2,2,2-trideuterioacetyl 2,2,2-trideuterioacetate |
| IUPAC Name | (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate |
| InChI Key | WFDIJRYMOXRFFG-WFGJKAKNSA-N |
| Molecular Formula | C4H6O3 |
Methyl sulfoxide-d6, for NMR, packaged in 0.50 ml ampoules, 100.0 atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Dichloromethane-d2, for NMR, 99.8 atom % D
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.94 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N IUPAC Name: dichloro(²H₂)methane SMILES: [2H]C([2H])(Cl)Cl
| CAS | 1665-00-5 |
|---|---|
| Molecular Weight (g/mol) | 86.94 |
| SMILES | [2H]C([2H])(Cl)Cl |
| IUPAC Name | dichloro(²H₂)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
p-Xylene, 99+%, extra pure
CAS: 106-42-3 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 MDL Number: MFCD00008556 InChI Key: URLKBWYHVLBVBO-UHFFFAOYSA-N Synonym: p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene PubChem CID: 7809 ChEBI: CHEBI:27417 IUPAC Name: 1,4-xylene SMILES: CC1=CC=C(C)C=C1
| PubChem CID | 7809 |
|---|---|
| CAS | 106-42-3 |
| Molecular Weight (g/mol) | 106.17 |
| ChEBI | CHEBI:27417 |
| MDL Number | MFCD00008556 |
| SMILES | CC1=CC=C(C)C=C1 |
| Synonym | p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene |
| IUPAC Name | 1,4-xylene |
| InChI Key | URLKBWYHVLBVBO-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
Ethylene glycol-d{6}, 98% (Isotopic)
CAS: 15054-86-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 68.11 MDL Number: MFCD00078666 InChI Key: LYCAIKOWRPUZTN-UFSLNRCZSA-N Synonym: ethylene glycol-d6,1,1,2,2-2h4 ethane-1,2-2h2 diol,1,2-ethane-1,1,2,2-d4-diol-d2,2 h? ethane-1,2-di 2 h ol,ethylen-d4 glycol-d2,ethylene glycol d6,ethylene glycol-d6, 98 atom % d,ethylene glycol-d6 >99.0 atom % d PubChem CID: 2733139 IUPAC Name: (²H₄)ethane-1,2-di(²H)ol SMILES: [2H]OC([2H])([2H])C([2H])([2H])O[2H]
| PubChem CID | 2733139 |
|---|---|
| CAS | 15054-86-1 |
| Molecular Weight (g/mol) | 68.11 |
| MDL Number | MFCD00078666 |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])O[2H] |
| Synonym | ethylene glycol-d6,1,1,2,2-2h4 ethane-1,2-2h2 diol,1,2-ethane-1,1,2,2-d4-diol-d2,2 h? ethane-1,2-di 2 h ol,ethylen-d4 glycol-d2,ethylene glycol d6,ethylene glycol-d6, 98 atom % d,ethylene glycol-d6 >99.0 atom % d |
| IUPAC Name | (²H₄)ethane-1,2-di(²H)ol |
| InChI Key | LYCAIKOWRPUZTN-UFSLNRCZSA-N |
| Molecular Formula | C2H6O2 |
iso-Butyl Alcohol, ACS, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 78-83-1 Molecular Weight (g/mol): 74.12
| CAS | 78-83-1 |
|---|---|
| Molecular Weight (g/mol) | 74.12 |